ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1019 CAS 3326-32-7



FLUORESCEIN 5-ISOTHIOCYANATE
CAS 3326-32-7
ID 1019

Molecular Formula   C21H11NO5S
Molecular Weight     389.381
SmileCode               Oc1ccc2c(Oc3cc(O)ccc3C24OC(=O)c5cc(ccc45)N=C=S)c1

Quantity | Price        10g | 770 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com