ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1023 CAS 129295-31-4



6-CHLORO-1H-INDAZOLE-3-CARBOXYLIC ACID
CAS 129295-31-4
ID 1023

Molecular Formula   C8H5ClN2O2
Molecular Weight     196.590
SmileCode               OC(=O)c1n[nH]c2cc(Cl)ccc12

Quantity | Price        25g | 810 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com