ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1037 CAS 951884-77-8



4-(3-BROMO-5-TRIFLUOROMETHYLPHENYLSULFONYL)MORPHOLINE
CAS 951884-77-8
ID 1037

Molecular Formula   C11H11BrF3NO3S
Molecular Weight     374.172
SmileCode               FC(F)(F)c1cc(Br)cc(c1)[S](=O)(=O)N2CCOCC2

Quantity | Price        5g | 980 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com