ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1042 CAS 883899-06-7



2-CHLORO-6-(5,5-DIMETHYL-1,3,2-DIOXABORINAN-2-YL)BENZONITRILE
CAS 883899-06-7
ID 1042

Molecular Formula   C12H13BClNO2
Molecular Weight     249.501
SmileCode               CC1(C)COB(OC1)c2cccc(Cl)c2C#N

Quantity | Price        5g | 1010 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com