ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1046 CAS 72846-00-5



1-PHENYLMETHYL-5-PHENYL-BARBITURIC ACID
CAS 72846-00-5
ID 1046

Molecular Formula   C17H14N2O3
Molecular Weight     294.310
SmileCode               O=C1NC(=O)N(Cc2ccccc2)C(=O)C1c3ccccc3

Quantity | Price        1000g | 1200 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com