ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1047 CAS 909187-64-0



6-BENZYL-4,5,6,7-TETRAHYDRO-1H-PYRAZOLO[3,4-C]PYRIDIN-3(2H)-ONE
CAS 909187-64-0
ID 1047

Molecular Formula   C13H15N3O
Molecular Weight     229.283
SmileCode               O=C1NNC2=C1CCN(Cc3ccccc3)C2

Quantity | Price        5g | 1110 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com