ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1050 CAS 149104-88-1



4-​(METHANESULFONYL)​PHENYLBORONIC ACID
CAS 149104-88-1
ID 1050

Molecular Formula   C7H9BO4S
Molecular Weight     200.015
SmileCode               C[S](=O)(=O)c1ccc(cc1)B(O)O

Quantity | Price        100g | 1130 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com