ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1057 CAS 62559-08-4



BENZENE, 4-(1,1-DIMETHYLETHYL)-1-METHYL-2-NITRO-
CAS 62559-08-4
ID 1057

Molecular Formula   C11H15NO2
Molecular Weight     193.246
SmileCode               Cc1ccc(cc1[N+]([O-])=O)C(C)(C)C

Quantity | Price        1g | 1240 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com