ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1060 CAS 15796-82-4



BIS(4-(TERT-BUTYL)PHENYL)METHANONE
CAS 15796-82-4
ID 1060

Molecular Formula   C21H26O
Molecular Weight     294.438
SmileCode               CC(C)(C)c1ccc(cc1)C(=O)c2ccc(cc2)C(C)(C)C

Quantity | Price        200g | 1240 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com