ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1064 CAS 4651-67-6



(4R)-4-[(3R,5S,8R,9S,10S,13R,14S,17R)-3-HYDROXY-10,13-DIMETHYL-7-OXO-1,2,3,4,5,6,8,9,11,12,14,15,16,17-TETRADECAHYDROCYCLOPENTA[A]PHENANTHREN-17-YL]PENTANOIC ACID
CAS 4651-67-6
ID 1064

Molecular Formula   C24H38O4
Molecular Weight     390.564
SmileCode               C[C@H](CCC(O)=O)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]4(C)CC[C@@H](O)C[C@H]4CC3=O

Quantity | Price        100g | 1310 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com