ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1067 CAS 10538-59-7



METHYL 7-KETO-3α-HYDROXY-5β-CHOLANOATE
CAS 10538-59-7
ID 1067

Molecular Formula   C25H40O4
Molecular Weight     404.591
SmileCode               COC(=O)CC[C@@H](C)[C@H]1CC[C@H]2[C@H]3[C@H](CC[C@]12C)[C@@]4(C)CC[C@@H](O)C[C@H]4CC3=O

Quantity | Price        100g | 1440 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com