ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1072 CAS 153371-25-6



CARBAMIC ACID, [(1S)-1-FORMYLPROPYL]-, 1,1-DIMETHYLETHYL ESTER
CAS 153371-25-6
ID 1072

Molecular Formula   C9H17NO3
Molecular Weight     187.239
SmileCode               CC[C@H](NC(=O)OC(C)(C)C)C=O

Quantity | Price        1g | 1600 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com