ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1073 CAS 817638-68-9



3-AZIDO-7-HYDROXY-CHROMEN-2-ONE
CAS 817638-68-9
ID 1073

Molecular Formula   C9H5N3O3
Molecular Weight     203.157
SmileCode               Oc1ccc2C=C(N=[N+]=[N-])C(=O)Oc2c1

Quantity | Price        10g | 1610 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com