ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1075 CAS 330804-03-0



2-METHYLSULFONYLPHENYLBORONIC ACID
CAS 330804-03-0
ID 1075

Molecular Formula   C7H9BO4S
Molecular Weight     200.015
SmileCode               C[S](=O)(=O)c1ccccc1B(O)O

Quantity | Price        25g | 1630 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com