ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1082 CAS 1365272-87-2



2-FLUORO-1-NITRO-3-(TRIFLUOROMETHOXY)BENZENE
CAS 1365272-87-2
ID 1082

Molecular Formula   C7H3F4NO3
Molecular Weight     225.099
SmileCode               [O-][N+](=O)c1cccc(OC(F)(F)F)c1F

Quantity | Price        5g | 1890 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com