ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1083 CAS 75735-44-3



METHYL 3-NITROTHIOPHENE-2-CARBOXYLATE
CAS 75735-44-3
ID 1083

Molecular Formula   C6H5NO4S
Molecular Weight     187.169
SmileCode               COC(=O)c1sccc1[N+]([O-])=O

Quantity | Price        10g | 1910 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com