ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1086 CAS 2183-17-7



DISODIUM 1-NAPHTHYL PHOSPHATE
CAS 2183-17-7
ID 1086

Molecular Formula   C10H7Na2O4P
Molecular Weight     268.115
SmileCode               [Na+].[Na+].[O-][P]([O-])(=O)Oc1cccc2ccccc12

Quantity | Price        20g | 1940 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com