ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1089 CAS 75621-03-3



3-[(3-CHOLAMIDOPROPYL)DIMETHYLAMMONIO]-1-PROPANESULFONATE
CAS 75621-03-3
ID 1089

Molecular Formula   C32H58N2O7S
Molecular Weight     614.883
SmileCode               C[C@H](CCC(=O)NCCC[N+](C)(C)CCC[S]([O-])(=O)=O)[C@H]1CC[C@H]2[C@@H]3[C@H](O)C[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3C[C@H](O)[C@]12C

Quantity | Price        1000g | 1960 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com