ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1102 CAS 799842-07-2



5-(BROMOMETHYL)-4-(4-FLUOROPHENYL)-6-ISOPROPYL-2-[METHYL(METHYLSULFONYL)AMINO]PYRIMIDINE
CAS 799842-07-2
ID 1102

Molecular Formula   C16H19BrFN3O2S
Molecular Weight     416.309
SmileCode               CC(C)c1nc(nc(c2ccc(F)cc2)c1CBr)N(C)[S](C)(=O)=O

Quantity | Price        25g | 2280 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com