ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1110 CAS 84457-22-7



9-METHYL-10-NITROANTHRACENE
CAS 84457-22-7
ID 1110

Molecular Formula   C15H11NO2
Molecular Weight     237.258
SmileCode               Cc1c2ccccc2c(c3ccccc13)[N+]([O-])=O

Quantity | Price        5g | 2580 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com