ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1114 CAS 89336-46-9



4-THIAZOLEACETIC ACID, 2-[[(1,1-DIMETHYLETHOXY)CARBONYL]AMINO]-
CAS 89336-46-9
ID 1114

Molecular Formula   C10H14N2O4S
Molecular Weight     258.292
SmileCode               CC(C)(C)OC(=O)Nc1scc(CC(O)=O)n1

Quantity | Price        100g | 2740 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com