ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1127 CAS 78228-00-9



4-(METHYLTHIO)-2-NITROTOLUENE
CAS 78228-00-9
ID 1127

Molecular Formula   C8H9NO2S
Molecular Weight     183.225
SmileCode               CSc1ccc(C)c(c1)[N+]([O-])=O

Quantity | Price        25g | 3000 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com