ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1134 CAS 91809-67-5



6-CARBOXYTETRAMETHYLRHODAMINE
CAS 91809-67-5
ID 1134

Molecular Formula   C25H22N2O5
Molecular Weight     430.460
SmileCode               CN(C)c1ccc2c(c1)[o+]c3cc(ccc3c2c4cc(ccc4C(O)=O)C([O-])=O)N(C)C

Quantity | Price        10g | 3420 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com