ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1135 CAS 800401-70-1



ETHYL 5-BROMO-1H-PYRROLO-[2,3-C]-PYRIDINE-2-CARBOXYLATE
CAS 800401-70-1
ID 1135

Molecular Formula   C10H9BrN2O2
Molecular Weight     269.098
SmileCode               CCOC(=O)c1[nH]c2cnc(Br)cc2c1

Quantity | Price        25g | 3450 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com