ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1147 CAS 99839-45-9



METHYL 5-BROMO-3-NITROTHIOPHENE-2-CARBOXYLATE
CAS 99839-45-9
ID 1147

Molecular Formula   C6H4BrNO4S
Molecular Weight     266.065
SmileCode               COC(=O)c1sc(Br)cc1[N+]([O-])=O

Quantity | Price        50g | 4800 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com