ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1153 CAS 289656-45-7



2,2-BIS(4-FLUOROPHENYL)-2-PHENYLACETAMIDE
CAS 289656-45-7
ID 1153

Molecular Formula   C20H15F2NO
Molecular Weight     323.343
SmileCode               NC(=O)C(c1ccccc1)(c2ccc(F)cc2)c3ccc(F)cc3

Quantity | Price        25g | 6610 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com