ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1156 CAS 934240-30-9



(2S,5R)-5-[4-[(2-FLUOROPHENYL)METHOXY]PHENYL]PYRROLIDINE-2-CARBOXAMIDE
CAS 934240-30-9
ID 1156

Molecular Formula   C18H19FN2O2
Molecular Weight     314.360
SmileCode               NC(=O)[C@@H]1CC[C@@H](N1)c2ccc(OCc3ccccc3F)cc2

Quantity | Price        10g | 8800 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com