ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1170 CAS 241819-85-2



TERT-BUTYL 2-OXOSPIRO[1H-INDENE-3,4'-PIPERIDINE]-1'-CARBOXYLATE
CAS 241819-85-2
ID 1170

Molecular Formula   C18H23NO3
Molecular Weight     301.386
SmileCode               CC(C)(C)OC(=O)N1CCC2(CC1)C(=O)Cc3ccccc23

Quantity | Price        100g | 13200 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com