ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 1174 CAS 141449-85-6



TERT-BUTYL HEXAHYDROPYRROLO[3,4-C]PYRROLE-2(1H)-CARBOXYLATE
CAS 141449-85-6
ID 1174

Molecular Formula   C11H20N2O2
Molecular Weight     212.293
SmileCode               CC(C)(C)OC(=O)N1CC2CNCC2C1

Quantity | Price        50g | 8000 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com