ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5559 CAS 63056-20-2



6-PHENYLPYRIDINE-3-CARBALDEHYDE
CAS 63056-20-2
ID 5559

Molecular Formula   C12H9NO
Molecular Weight     183.21
SmileCode               C1=CC=C(C=C1)C2=NC=C(C=C2)C=O

Quantity | Price        5g | 1100 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com