ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5564 CAS 1392512-54-7



(4-FLUORO-2,6-DIMETHYLPHENYL)BORONIC ACID
CAS 1392512-54-7
ID 5564

Molecular Formula   C8H10BFO2
Molecular Weight     167.97
SmileCode               B(C1=C(C=C(C=C1C)F)C)(O)O

Quantity | Price        5g | 1100 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com