ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5565 CAS 149507-37-9



(4-METHOXY-2,3-DIMETHYLPHENYL)BORONIC ACID
CAS 149507-37-9
ID 5565

Molecular Formula   C9H13BO3
Molecular Weight     180.01
SmileCode               B(C1=C(C(=C(C=C1)OC)C)C)(O)O

Quantity | Price        5g | 1100 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com