ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5569 CAS 1378666-16-0



4-FLUORO-2-PROPOXYBENZOIC ACID
CAS 1378666-16-0
ID 5569

Molecular Formula   C10H11FO3
Molecular Weight     198.19
SmileCode               CCCOC1=C(C=CC(=C1)F)C(=O)O

Quantity | Price        5g | 1100 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com