ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5575 CAS 1269440-82-5



3-BROMO-5-CHLORO-2-FLUOROBENZALDEHYDE
CAS 1269440-82-5
ID 5575

Molecular Formula   C7H3BrClFO
Molecular Weight     237.45
SmileCode               C1=C(C=C(C(=C1Br)F)C=O)Cl

Quantity | Price        5g | 1100 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com