ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5578 CAS 1214362-28-3



METHYL 2-BROMO-3-(TRIFLUOROMETHYL)BENZOATE
CAS 1214362-28-3
ID 5578

Molecular Formula   C9H6BrF3O2
Molecular Weight     283.04
SmileCode               COC(=O)C1=C(C(=CC=C1)C(F)(F)F)Br

Quantity | Price        5g | 1100 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com