ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5587 CAS 864771-44-8



TERT-BUTYL 5-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)INDAZOLE-1-CARBOXYLATE
CAS 864771-44-8
ID 5587

Molecular Formula   C18H25BN2O4
Molecular Weight     344.22
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(N=C3)C(=O)OC(C)(C)C

Quantity | Price        5g | 1110 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com