ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5588 CAS 125036-88-6



3,5-DIFLUORO-4-PHENYLMETHOXYBENZALDEHYDE
CAS 125036-88-6
ID 5588

Molecular Formula   C14H10F2O2
Molecular Weight     248.23
SmileCode               C1=CC=C(C=C1)COC2=C(C=C(C=C2F)C=O)F

Quantity | Price        5g | 1110 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com