ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5595 CAS 1256355-51-7



[2-CHLORO-6-(METHOXYMETHOXY)PHENYL]BORONIC ACID
CAS 1256355-51-7
ID 5595

Molecular Formula   C8H10BClO4
Molecular Weight     216.42
SmileCode               B(C1=C(C=CC=C1Cl)OCOC)(O)O

Quantity | Price        5g | 1120 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com