ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5608 CAS 773874-13-8



METHYL 5-BROMO-2-(TRIFLUOROMETHOXY)BENZOATE
CAS 773874-13-8
ID 5608

Molecular Formula   C9H6BrF3O3
Molecular Weight     299.04
SmileCode               COC(=O)C1=C(C=CC(=C1)Br)OC(F)(F)F

Quantity | Price        5g | 1140 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com