ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5611 CAS 867333-43-5



(5-CYANO-2-METHYLPHENYL)BORONIC ACID
CAS 867333-43-5
ID 5611

Molecular Formula   C8H8BNO2
Molecular Weight     160.97
SmileCode               B(C1=C(C=CC(=C1)C#N)C)(O)O

Quantity | Price        5g | 1150 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com