ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5612 CAS 863868-32-0



4-METHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)BENZONITRILE
CAS 863868-32-0
ID 5612

Molecular Formula   C14H18BNO2
Molecular Weight     243.11
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C#N)C

Quantity | Price        5g | 1150 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com