ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5622 CAS 815620-00-9



(4-FORMYL-3-METHOXYPHENYL)BORONIC ACID
CAS 815620-00-9
ID 5622

Molecular Formula   C8H9BO4
Molecular Weight     179.97
SmileCode               B(C1=CC(=C(C=C1)C=O)OC)(O)O

Quantity | Price        5g | 1160 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com