ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5626 CAS 863578-36-3



5-METHYL-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS 863578-36-3
ID 5626

Molecular Formula   C13H20BNO2
Molecular Weight     233.12
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=C(C=C(C=C2)C)N

Quantity | Price        5g | 1170 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com