ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5630 CAS 913836-03-0



5-BORONOPYRIDINE-3-CARBOXYLIC ACID
CAS 913836-03-0
ID 5630

Molecular Formula   C6H6BNO4
Molecular Weight     166.93
SmileCode               B(C1=CC(=CN=C1)C(=O)O)(O)O

Quantity | Price        5g | 1170 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com