ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5636 CAS 1451392-55-4



(5-CHLORO-2-METHYLSULFANYLPHENYL)BORONIC ACID
CAS 1451392-55-4
ID 5636

Molecular Formula   C7H8BClO2S
Molecular Weight     202.46
SmileCode               B(C1=C(C=CC(=C1)Cl)SC)(O)O

Quantity | Price        5g | 1170 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com