ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5637 CAS 1073371-77-3



4-CHLORO-2-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)ANILINE
CAS 1073371-77-3
ID 5637

Molecular Formula   C12H17BClNO2
Molecular Weight     253.53
SmileCode               B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)Cl)N

Quantity | Price        5g | 1170 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com