ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5641 CAS 86569-78-0



METHYL 2,4,6-TRICHLOROBENZOATE
CAS 86569-78-0
ID 5641

Molecular Formula   C8H5Cl3O2
Molecular Weight     239.48
SmileCode               COC(=O)C1=C(C=C(C=C1Cl)Cl)Cl

Quantity | Price        5g | 1170 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com