ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5645 CAS 179257-30-8



2-PHENYLMETHOXYPYRIDINE-3-CARBALDEHYDE
CAS 179257-30-8
ID 5645

Molecular Formula   C13H11NO2
Molecular Weight     213.24
SmileCode               C1=CC=C(C=C1)COC2=C(C=CC=N2)C=O

Quantity | Price        5g | 1170 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com