ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5648 CAS 1217500-96-3



(3-FLUORO-5-PYRROLIDIN-1-YLPHENYL)BORONIC ACID
CAS 1217500-96-3
ID 5648

Molecular Formula   C10H13BFNO2
Molecular Weight     209.03
SmileCode               B(C1=CC(=CC(=C1)F)N2CCCC2)(O)O

Quantity | Price        5g | 1180 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com