ORGANIC INTERMEDIATES    RESEARCH CHEMICALS   CUSTOM SYNTHESIS   BUILDING BLOCKS   HETEROCYCLES   METABOLITES   IMPURITIES

ID 5651 CAS 1003298-72-3



(3-CHLORO-5-FLUORO-4-HYDROXYPHENYL)BORONIC ACID
CAS 1003298-72-3
ID 5651

Molecular Formula   C6H5BClFO3
Molecular Weight     190.36
SmileCode               B(C1=CC(=C(C(=C1)Cl)O)F)(O)O

Quantity | Price        5g | 1190 USD
Availability               Typically in stock


Inquiry : contact[at]arenachemical.com